C19H29N3O — CID 122565526
(1S,5R)-6-[(dimethylamino)methyl]-N-[3-(3-methylphenyl)propyl]-3-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 122565526) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is (1S,5R)-6-[(dimethylamino)methyl]-N-[3-(3-methylphenyl)propyl]-3-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1S,5R)-6-[(dimethylamino)methyl]-N-[3-(3-methylphenyl)propyl]-3-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 122565526 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | (1S,5R)-6-[(dimethylamino)methyl]-N-[3-(3-methylphenyl)propyl]-3-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | Cc1cccc(CCCNC(=O)N2C[C@@H]3C(CN(C)C)[C@@H]3C2)c1 |
| InChI | InChI=1S/C19H29N3O/c1-14-6-4-7-15(10-14)8-5-9-20-19(23)22-12-17-16(11-21(2)3)18(17)13-22/h4,6-7,10,16-18H,5,8-9,11-13H2,1-3H3,(H,20,23)/t16?,17-,18+ |
| InChIKey | LVGOZQYSDNYFSM-AYHJJNSGSA-N |
| XLogP | 2.38 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|