C15H19N3O4S — CID 122567822
5-[3-(1,4-diazepan-1-ylsulfonyl)-4-methoxyphenyl]-1,2-oxazole (PubChem CID 122567822) has the molecular formula C15H19N3O4S and a molecular weight of 337.40 g/mol. Its IUPAC name is 5-[3-(1,4-diazepan-1-ylsulfonyl)-4-methoxyphenyl]-1,2-oxazole.
| Compound Name | 5-[3-(1,4-diazepan-1-ylsulfonyl)-4-methoxyphenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 122567822 |
| Molecular Formula | C15H19N3O4S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 5-[3-(1,4-diazepan-1-ylsulfonyl)-4-methoxyphenyl]-1,2-oxazole |
| SMILES | COc1ccc(-c2ccno2)cc1S(=O)(=O)N1CCCNCC1 |
| InChI | InChI=1S/C15H19N3O4S/c1-21-14-4-3-12(13-5-7-17-22-13)11-15(14)23(19,20)18-9-2-6-16-8-10-18/h3-5,7,11,16H,2,6,8-10H2,1H3 |
| InChIKey | VMUARVIKGREMQU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |