C30H31F7O — CID 122578160
2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-[4-[(E)-2-(4-propylcyclohex-2-en-1-yl)ethenyl]cyclohexyl]benzene (PubChem CID 122578160) has the molecular formula C30H31F7O and a molecular weight of 540.56 g/mol. Its IUPAC name is 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-[4-[(E)-2-(4-propylcyclohex-2-en-1-yl)ethenyl]cyclohexyl]benzene.
| Compound Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-[4-[(E)-2-(4-propylcyclohex-2-en-1-yl)ethenyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 122578160 |
| Molecular Formula | C30H31F7O |
| Molecular Weight | 540.56 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluoro-5-[4-[(E)-2-(4-propylcyclohex-2-en-1-yl)ethenyl]cyclohexyl]benzene |
| SMILES | CCCC1C=CC(/C=C/C2CCC(c3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C30H31F7O/c1-2-3-18-4-6-19(7-5-18)8-9-20-10-12-21(13-11-20)22-14-24(31)28(25(32)15-22)30(36,37)38-23-16-26(33)29(35)27(34)17-23/h4,6,8-9,14-21H,2-3,5,7,10-13H2,1H3/b9-8+ |
| InChIKey | FJCHEFLIOLGGGN-CMDGGOBGSA-N |
| XLogP | 9.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.56 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|