C31H33F9O — CID 122578154
2-[[3,5-difluoro-4-(trifluoromethyl)phenoxy]-difluoromethyl]-1,3-difluoro-5-[4-(4-pentylcyclohex-2-en-1-yl)cyclohexyl]benzene (PubChem CID 122578154) has the molecular formula C31H33F9O and a molecular weight of 592.59 g/mol. Its IUPAC name is 2-[[3,5-difluoro-4-(trifluoromethyl)phenoxy]-difluoromethyl]-1,3-difluoro-5-[4-(4-pentylcyclohex-2-en-1-yl)cyclohexyl]benzene.
| Compound Name | 2-[[3,5-difluoro-4-(trifluoromethyl)phenoxy]-difluoromethyl]-1,3-difluoro-5-[4-(4-pentylcyclohex-2-en-1-yl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 122578154 |
| Molecular Formula | C31H33F9O |
| Molecular Weight | 592.59 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | 2-[[3,5-difluoro-4-(trifluoromethyl)phenoxy]-difluoromethyl]-1,3-difluoro-5-[4-(4-pentylcyclohex-2-en-1-yl)cyclohexyl]benzene |
| SMILES | CCCCCC1C=CC(C2CCC(c3cc(F)c(C(F)(F)Oc4cc(F)c(C(F)(F)F)c(F)c4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C31H33F9O/c1-2-3-4-5-18-6-8-19(9-7-18)20-10-12-21(13-11-20)22-14-24(32)29(25(33)15-22)31(39,40)41-23-16-26(34)28(27(35)17-23)30(36,37)38/h6,8,14-21H,2-5,7,9-13H2,1H3 |
| InChIKey | JDZOPFWJJKSVKT-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.59 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|