C21H27N3O6 — CID 122580660
ethyl (E)-3-[[(2S)-1-(2-acetamidoacetyl)-2,3-dihydroindole-2-carbonyl]amino]-4-ethoxybut-3-enoate (PubChem CID 122580660) has the molecular formula C21H27N3O6 and a molecular weight of 417.46 g/mol. Its IUPAC name is ethyl (E)-3-[[(2S)-1-(2-acetamidoacetyl)-2,3-dihydroindole-2-carbonyl]amino]-4-ethoxybut-3-enoate.
| Compound Name | ethyl (E)-3-[[(2S)-1-(2-acetamidoacetyl)-2,3-dihydroindole-2-carbonyl]amino]-4-ethoxybut-3-enoate |
|---|---|
| PubChem CID | 122580660 |
| Molecular Formula | C21H27N3O6 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | ethyl (E)-3-[[(2S)-1-(2-acetamidoacetyl)-2,3-dihydroindole-2-carbonyl]amino]-4-ethoxybut-3-enoate |
| SMILES | CCO/C=C(\CC(=O)OCC)NC(=O)[C@@H]1Cc2ccccc2N1C(=O)CNC(C)=O |
| InChI | InChI=1S/C21H27N3O6/c1-4-29-13-16(11-20(27)30-5-2)23-21(28)18-10-15-8-6-7-9-17(15)24(18)19(26)12-22-14(3)25/h6-9,13,18H,4-5,10-12H2,1-3H3,(H,22,25)(H,23,28)/b16-13+/t18-/m0/s1 |
| InChIKey | PPJABVIBZQVNCB-QCUIPMNBSA-N |
| XLogP | 1.03 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|