C13H18N3O7P — CID 122592761
[(2R,4R,5R)-3,4-dihydroxy-5-(6-methyl-2-methylidene-7H-pyrrolo[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 122592761) has the molecular formula C13H18N3O7P and a molecular weight of 359.28 g/mol. Its IUPAC name is [(2R,4R,5R)-3,4-dihydroxy-5-(6-methyl-2-methylidene-7H-pyrrolo[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,4R,5R)-3,4-dihydroxy-5-(6-methyl-2-methylidene-7H-pyrrolo[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 122592761 |
| Molecular Formula | C13H18N3O7P |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | [(2R,4R,5R)-3,4-dihydroxy-5-(6-methyl-2-methylidene-7H-pyrrolo[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | C=C1N=c2[nH]c(C)cc2=CN1[C@@H]1O[C@H](COP(=O)(O)O)C(O)[C@H]1O |
| InChI | InChI=1S/C13H18N3O7P/c1-6-3-8-4-16(7(2)15-12(8)14-6)13-11(18)10(17)9(23-13)5-22-24(19,20)21/h3-4,9-11,13,17-18H,2,5H2,1H3,(H,14,15)(H2,19,20,21)/t9-,10?,11-,13-/m1/s1 |
| InChIKey | BDUNJMNOHBWANN-APTVDZGQSA-N |
| XLogP | -1.98 |
| TPSA | 147.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|