C10H16N3O8P — CID 174088258
[(2R,4S,5R)-5-(4-aminooxy-2-methylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 174088258) has the molecular formula C10H16N3O8P and a molecular weight of 337.23 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(4-aminooxy-2-methylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,4S,5R)-5-(4-aminooxy-2-methylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 174088258 |
| Molecular Formula | C10H16N3O8P |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | [(2R,4S,5R)-5-(4-aminooxy-2-methylidenepyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | C=C1N=C(ON)C=CN1[C@@H]1O[C@H](COP(=O)(O)O)C(O)[C@@H]1O |
| InChI | InChI=1S/C10H16N3O8P/c1-5-12-7(21-11)2-3-13(5)10-9(15)8(14)6(20-10)4-19-22(16,17)18/h2-3,6,8-10,14-15H,1,4,11H2,(H2,16,17,18)/t6-,8?,9+,10-/m1/s1 |
| InChIKey | DWKDKTCCXZOGMK-HZRXXTQPSA-N |
| XLogP | -1.87 |
| TPSA | 167.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|