C12H17N2O9P — CID 170065680
[(3S,4R)-3,4-dihydroxy-5-[5-(hydroxyamino)-3-methylidene-2-oxoazepin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 170065680) has the molecular formula C12H17N2O9P and a molecular weight of 364.25 g/mol. Its IUPAC name is [(3S,4R)-3,4-dihydroxy-5-[5-(hydroxyamino)-3-methylidene-2-oxoazepin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(3S,4R)-3,4-dihydroxy-5-[5-(hydroxyamino)-3-methylidene-2-oxoazepin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 170065680 |
| Molecular Formula | C12H17N2O9P |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | [(3S,4R)-3,4-dihydroxy-5-[5-(hydroxyamino)-3-methylidene-2-oxoazepin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | C=C1C=C(NO)C=CN(C2OC(COP(=O)(O)O)[C@@H](O)[C@H]2O)C1=O |
| InChI | InChI=1S/C12H17N2O9P/c1-6-4-7(13-18)2-3-14(11(6)17)12-10(16)9(15)8(23-12)5-22-24(19,20)21/h2-4,8-10,12-13,15-16,18H,1,5H2,(H2,19,20,21)/t8?,9-,10-,12?/m1/s1 |
| InChIKey | OXEFCWPCLUZSNI-WDHPUFTPSA-N |
| XLogP | -1.68 |
| TPSA | 169.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|