C12H21N3O10P2 — CID 161021300
[[(2R,3R,5R)-3,4-dihydroxy-5-[4-(methoxyamino)-2-methylidenepyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 161021300) has the molecular formula C12H21N3O10P2 and a molecular weight of 429.26 g/mol. Its IUPAC name is [[(2R,3R,5R)-3,4-dihydroxy-5-[4-(methoxyamino)-2-methylidenepyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3R,5R)-3,4-dihydroxy-5-[4-(methoxyamino)-2-methylidenepyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 161021300 |
| Molecular Formula | C12H21N3O10P2 |
| Molecular Weight | 429.26 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | [[(2R,3R,5R)-3,4-dihydroxy-5-[4-(methoxyamino)-2-methylidenepyrimidin-1-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | C=C1N=C(NOC)C=CN1[C@@H]1O[C@H](COP(=O)(O)CP(=O)(O)O)[C@H](O)C1O |
| InChI | InChI=1S/C12H21N3O10P2/c1-7-13-9(14-23-2)3-4-15(7)12-11(17)10(16)8(25-12)5-24-27(21,22)6-26(18,19)20/h3-4,8,10-12,16-17H,1,5-6H2,2H3,(H,13,14)(H,21,22)(H2,18,19,20)/t8-,10+,11?,12-/m1/s1 |
| InChIKey | XJCQRTJVASHLPN-ZLBUMYCKSA-N |
| XLogP | -1.38 |
| TPSA | 190.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.26 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|