C10H16NO8P — CID 177270685
[(2R,5R)-3,4-dihydroxy-5-(4-oxo-2,3-dihydropyridin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 177270685) has the molecular formula C10H16NO8P and a molecular weight of 309.21 g/mol. Its IUPAC name is [(2R,5R)-3,4-dihydroxy-5-(4-oxo-2,3-dihydropyridin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,5R)-3,4-dihydroxy-5-(4-oxo-2,3-dihydropyridin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 177270685 |
| Molecular Formula | C10H16NO8P |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | [(2R,5R)-3,4-dihydroxy-5-(4-oxo-2,3-dihydropyridin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=C1C=CN([C@@H]2O[C@H](COP(=O)(O)O)C(O)C2O)CC1 |
| InChI | InChI=1S/C10H16NO8P/c12-6-1-3-11(4-2-6)10-9(14)8(13)7(19-10)5-18-20(15,16)17/h1,3,7-10,13-14H,2,4-5H2,(H2,15,16,17)/t7-,8?,9?,10-/m1/s1 |
| InChIKey | YWSHRRSXPSEQBW-SEZDTBSWSA-N |
| XLogP | -1.67 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|