C11H16NO9P — CID 163174268
1-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-2H-pyridine-3-carboxylic acid (PubChem CID 163174268) has the molecular formula C11H16NO9P and a molecular weight of 337.22 g/mol. Its IUPAC name is 1-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-2H-pyridine-3-carboxylic acid.
| Compound Name | 1-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-2H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 163174268 |
| Molecular Formula | C11H16NO9P |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 1-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-2H-pyridine-3-carboxylic acid |
| SMILES | O=C(O)C1=CC=CN([C@H]2O[C@@H](COP(=O)(O)O)[C@H](O)[C@@H]2O)C1 |
| InChI | InChI=1S/C11H16NO9P/c13-8-7(5-20-22(17,18)19)21-10(9(8)14)12-3-1-2-6(4-12)11(15)16/h1-3,7-10,13-14H,4-5H2,(H,15,16)(H2,17,18,19)/t7-,8-,9-,10-/m0/s1 |
| InChIKey | WPQGXYKVVNQPPC-XKNYDFJKSA-N |
| XLogP | -1.62 |
| TPSA | 156.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|