C11H17N2O8P — CID 163142578
[(2R,3S,4R,5R)-5-(3-carbamoyl-2H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 163142578) has the molecular formula C11H17N2O8P and a molecular weight of 336.24 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(3-carbamoyl-2H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(3-carbamoyl-2H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 163142578 |
| Molecular Formula | C11H17N2O8P |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(3-carbamoyl-2H-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | NC(=O)C1=CC=CN([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)C1 |
| InChI | InChI=1S/C11H17N2O8P/c12-10(16)6-2-1-3-13(4-6)11-9(15)8(14)7(21-11)5-20-22(17,18)19/h1-3,7-9,11,14-15H,4-5H2,(H2,12,16)(H2,17,18,19)/t7-,8-,9-,11-/m1/s1 |
| InChIKey | KILUOVUPKLWOFR-TURQNECASA-N |
| XLogP | -2.22 |
| TPSA | 162.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|