C19H13F3N4 — CID 122597988
6-[2-(2,3,4-trifluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]imidazo[1,2-a]pyridine (PubChem CID 122597988) has the molecular formula C19H13F3N4 and a molecular weight of 354.34 g/mol. Its IUPAC name is 6-[2-(2,3,4-trifluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]imidazo[1,2-a]pyridine.
| Compound Name | 6-[2-(2,3,4-trifluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 122597988 |
| Molecular Formula | C19H13F3N4 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 6-[2-(2,3,4-trifluorophenyl)-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl]imidazo[1,2-a]pyridine |
| SMILES | Fc1ccc(-c2nn3c(c2-c2ccc4nccn4c2)CCC3)c(F)c1F |
| InChI | InChI=1S/C19H13F3N4/c20-13-5-4-12(17(21)18(13)22)19-16(14-2-1-8-26(14)24-19)11-3-6-15-23-7-9-25(15)10-11/h3-7,9-10H,1-2,8H2 |
| InChIKey | DJDMJZAPSKQJNS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|