C27H34O4S2 — CID 122603841
(4-methyl-1-phenoxydecan-5-yl) 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 122603841) has the molecular formula C27H34O4S2 and a molecular weight of 486.70 g/mol. Its IUPAC name is (4-methyl-1-phenoxydecan-5-yl) 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | (4-methyl-1-phenoxydecan-5-yl) 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 122603841 |
| Molecular Formula | C27H34O4S2 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | (4-methyl-1-phenoxydecan-5-yl) 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | CCCCCC(OC(=O)C(O)(c1cccs1)c1cccs1)C(C)CCCOc1ccccc1 |
| InChI | InChI=1S/C27H34O4S2/c1-3-4-6-15-23(21(2)12-9-18-30-22-13-7-5-8-14-22)31-26(28)27(29,24-16-10-19-32-24)25-17-11-20-33-25/h5,7-8,10-11,13-14,16-17,19-21,23,29H,3-4,6,9,12,15,18H2,1-2H3 |
| InChIKey | KDVPLEGDWJDTJD-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|