C20H24ClN — CID 122605589
(2R)-1-chloro-2-[1-(4-phenylphenyl)propyl]piperidine (PubChem CID 122605589) has the molecular formula C20H24ClN and a molecular weight of 313.87 g/mol. Its IUPAC name is (2R)-1-chloro-2-[1-(4-phenylphenyl)propyl]piperidine.
| Compound Name | (2R)-1-chloro-2-[1-(4-phenylphenyl)propyl]piperidine |
|---|---|
| PubChem CID | 122605589 |
| Molecular Formula | C20H24ClN |
| Molecular Weight | 313.87 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | (2R)-1-chloro-2-[1-(4-phenylphenyl)propyl]piperidine |
| SMILES | CCC(c1ccc(-c2ccccc2)cc1)[C@H]1CCCCN1Cl |
| InChI | InChI=1S/C20H24ClN/c1-2-19(20-10-6-7-15-22(20)21)18-13-11-17(12-14-18)16-8-4-3-5-9-16/h3-5,8-9,11-14,19-20H,2,6-7,10,15H2,1H3/t19?,20-/m1/s1 |
| InChIKey | FTMKUBSNYQBBNS-GFOWMXPYSA-N |
| XLogP | 5.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.87 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|