C7H16N2O — CID 122606327
N'-(2-methylprop-2-enoxy)propane-1,3-diamine (PubChem CID 122606327) has the molecular formula C7H16N2O and a molecular weight of 144.22 g/mol. Its IUPAC name is N'-(2-methylprop-2-enoxy)propane-1,3-diamine.
| Compound Name | N'-(2-methylprop-2-enoxy)propane-1,3-diamine |
|---|---|
| PubChem CID | 122606327 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | N'-(2-methylprop-2-enoxy)propane-1,3-diamine |
| SMILES | C=C(C)CONCCCN |
| InChI | InChI=1S/C7H16N2O/c1-7(2)6-10-9-5-3-4-8/h9H,1,3-6,8H2,2H3 |
| InChIKey | DHTSBZWRAKUDOS-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|