C8H8N8O — CID 122608290
1-hydroxy-N-(2H-tetrazol-5-ylmethyl)benzotriazol-5-amine (PubChem CID 122608290) has the molecular formula C8H8N8O and a molecular weight of 232.21 g/mol. Its IUPAC name is 1-hydroxy-N-(2H-tetrazol-5-ylmethyl)benzotriazol-5-amine.
| Compound Name | 1-hydroxy-N-(2H-tetrazol-5-ylmethyl)benzotriazol-5-amine |
|---|---|
| PubChem CID | 122608290 |
| Molecular Formula | C8H8N8O |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-hydroxy-N-(2H-tetrazol-5-ylmethyl)benzotriazol-5-amine |
| SMILES | On1nnc2cc(NCc3nn[nH]n3)ccc21 |
| InChI | InChI=1S/C8H8N8O/c17-16-7-2-1-5(3-6(7)10-15-16)9-4-8-11-13-14-12-8/h1-3,9,17H,4H2,(H,11,12,13,14) |
| InChIKey | DWZKFBAAAYKDGT-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|