C16H22N2O — CID 122609548
2-cyclohexyl-1-(6-methylimidazo[1,5-a]pyridin-8-yl)ethanol (PubChem CID 122609548) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-cyclohexyl-1-(6-methylimidazo[1,5-a]pyridin-8-yl)ethanol.
| Compound Name | 2-cyclohexyl-1-(6-methylimidazo[1,5-a]pyridin-8-yl)ethanol |
|---|---|
| PubChem CID | 122609548 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-cyclohexyl-1-(6-methylimidazo[1,5-a]pyridin-8-yl)ethanol |
| SMILES | Cc1cc(C(O)CC2CCCCC2)c2cncn2c1 |
| InChI | InChI=1S/C16H22N2O/c1-12-7-14(15-9-17-11-18(15)10-12)16(19)8-13-5-3-2-4-6-13/h7,9-11,13,16,19H,2-6,8H2,1H3 |
| InChIKey | XEKLYTJDQYLWDY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |