C15H19ClN2O — CID 155329640
(1R)-1-(7-chloroimidazo[1,5-a]pyridin-8-yl)-2-cyclohexylethanol (PubChem CID 155329640) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is (1R)-1-(7-chloroimidazo[1,5-a]pyridin-8-yl)-2-cyclohexylethanol.
| Compound Name | (1R)-1-(7-chloroimidazo[1,5-a]pyridin-8-yl)-2-cyclohexylethanol |
|---|---|
| PubChem CID | 155329640 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (1R)-1-(7-chloroimidazo[1,5-a]pyridin-8-yl)-2-cyclohexylethanol |
| SMILES | O[C@H](CC1CCCCC1)c1c(Cl)ccn2cncc12 |
| InChI | InChI=1S/C15H19ClN2O/c16-12-6-7-18-10-17-9-13(18)15(12)14(19)8-11-4-2-1-3-5-11/h6-7,9-11,14,19H,1-5,8H2/t14-/m1/s1 |
| InChIKey | GUFKPJINVSQRSN-CQSZACIVSA-N |
| XLogP | 3.99 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |