C34H50O7S — CID 122610950
1,4-bis(2-nonylphenoxy)-1,4-dioxobutane-2-sulfonic acid (PubChem CID 122610950) has the molecular formula C34H50O7S and a molecular weight of 602.83 g/mol. Its IUPAC name is 1,4-bis(2-nonylphenoxy)-1,4-dioxobutane-2-sulfonic acid.
| Compound Name | 1,4-bis(2-nonylphenoxy)-1,4-dioxobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 122610950 |
| Molecular Formula | C34H50O7S |
| Molecular Weight | 602.83 g/mol |
| Exact Mass | 602.33 |
| IUPAC Name | 1,4-bis(2-nonylphenoxy)-1,4-dioxobutane-2-sulfonic acid |
| SMILES | CCCCCCCCCc1ccccc1OC(=O)CC(C(=O)Oc1ccccc1CCCCCCCCC)S(=O)(=O)O |
| InChI | InChI=1S/C34H50O7S/c1-3-5-7-9-11-13-15-21-28-23-17-19-25-30(28)40-33(35)27-32(42(37,38)39)34(36)41-31-26-20-18-24-29(31)22-16-14-12-10-8-6-4-2/h17-20,23-26,32H,3-16,21-22,27H2,1-2H3,(H,37,38,39) |
| InChIKey | SHKAGVZUERPMKF-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.83 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|