C22H35NaO8S — CID 122613173
sodium;1-nonyl-2-propoxybenzene;2-sulfobutanedioic acid (PubChem CID 122613173) has the molecular formula C22H35NaO8S and a molecular weight of 482.57 g/mol. Its IUPAC name is sodium;1-nonyl-2-propoxybenzene;2-sulfobutanedioic acid.
| Compound Name | sodium;1-nonyl-2-propoxybenzene;2-sulfobutanedioic acid |
|---|---|
| PubChem CID | 122613173 |
| Molecular Formula | C22H35NaO8S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | sodium;1-nonyl-2-propoxybenzene;2-sulfobutanedioic acid |
| SMILES | CC[CH-]Oc1ccccc1CCCCCCCCC.O=C(O)CC(C(=O)O)S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C18H29O.C4H6O7S.Na/c1-3-5-6-7-8-9-10-13-17-14-11-12-15-18(17)19-16-4-2;5-3(6)1-2(4(7)8)12(9,10)11;/h11-12,14-16H,3-10,13H2,1-2H3;2H,1H2,(H,5,6)(H,7,8)(H,9,10,11);/q-1;;+1 |
| InChIKey | QKOLJWVUJPMOEI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|