C24H30O7S — CID 122611603
1,4-bis(2-butylphenoxy)-1,4-dioxobutane-2-sulfonic acid (PubChem CID 122611603) has the molecular formula C24H30O7S and a molecular weight of 462.56 g/mol. Its IUPAC name is 1,4-bis(2-butylphenoxy)-1,4-dioxobutane-2-sulfonic acid.
| Compound Name | 1,4-bis(2-butylphenoxy)-1,4-dioxobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 122611603 |
| Molecular Formula | C24H30O7S |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 1,4-bis(2-butylphenoxy)-1,4-dioxobutane-2-sulfonic acid |
| SMILES | CCCCc1ccccc1OC(=O)CC(C(=O)Oc1ccccc1CCCC)S(=O)(=O)O |
| InChI | InChI=1S/C24H30O7S/c1-3-5-11-18-13-7-9-15-20(18)30-23(25)17-22(32(27,28)29)24(26)31-21-16-10-8-14-19(21)12-6-4-2/h7-10,13-16,22H,3-6,11-12,17H2,1-2H3,(H,27,28,29) |
| InChIKey | JUZUXDUWYAYTQM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|