C23H39N5O8 — CID 122617262
ditert-butyl 2-[[3-[(2-azidoacetyl)amino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]pentanedioate (PubChem CID 122617262) has the molecular formula C23H39N5O8 and a molecular weight of 513.59 g/mol. Its IUPAC name is ditert-butyl 2-[[3-[(2-azidoacetyl)amino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]pentanedioate.
| Compound Name | ditert-butyl 2-[[3-[(2-azidoacetyl)amino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 122617262 |
| Molecular Formula | C23H39N5O8 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | ditert-butyl 2-[[3-[(2-azidoacetyl)amino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]amino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CCC(NC(=O)CC(NC(=O)CN=[N+]=[N-])C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H39N5O8/c1-21(2,3)34-18(31)11-10-14(19(32)35-22(4,5)6)26-16(29)12-15(20(33)36-23(7,8)9)27-17(30)13-25-28-24/h14-15H,10-13H2,1-9H3,(H,26,29)(H,27,30) |
| InChIKey | COKRLTFYSREDJG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 185.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|