C24H40N4O9 — CID 10951543
ditert-butyl (2S)-2-[[2-[(3aR,4S,6R,7R,7aS)-6-(azidomethyl)-7-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]acetyl]amino]pentanedioate (PubChem CID 10951543) has the molecular formula C24H40N4O9 and a molecular weight of 528.60 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[2-[(3aR,4S,6R,7R,7aS)-6-(azidomethyl)-7-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]acetyl]amino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[2-[(3aR,4S,6R,7R,7aS)-6-(azidomethyl)-7-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]acetyl]amino]pentanedioate |
|---|---|
| PubChem CID | 10951543 |
| Molecular Formula | C24H40N4O9 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | ditert-butyl (2S)-2-[[2-[(3aR,4S,6R,7R,7aS)-6-(azidomethyl)-7-hydroxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]acetyl]amino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)C[C@@H]1O[C@H](CN=[N+]=[N-])[C@@H](O)[C@@H]2OC(C)(C)O[C@@H]21)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H40N4O9/c1-22(2,3)34-17(30)10-9-13(21(32)37-23(4,5)6)27-16(29)11-14-19-20(36-24(7,8)35-19)18(31)15(33-14)12-26-28-25/h13-15,18-20,31H,9-12H2,1-8H3,(H,27,29)/t13-,14-,15+,18+,19+,20-/m0/s1 |
| InChIKey | ASSHCQNXHWZRLC-XGAXWPDCSA-N |
| XLogP | 2.28 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|