C14H24N4O8 — CID 91249880
methyl 2-[(2S,4S,5S)-6-(azidomethyl)-3,4,5-trihydroxyoxan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 91249880) has the molecular formula C14H24N4O8 and a molecular weight of 376.37 g/mol. Its IUPAC name is methyl 2-[(2S,4S,5S)-6-(azidomethyl)-3,4,5-trihydroxyoxan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | methyl 2-[(2S,4S,5S)-6-(azidomethyl)-3,4,5-trihydroxyoxan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 91249880 |
| Molecular Formula | C14H24N4O8 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | methyl 2-[(2S,4S,5S)-6-(azidomethyl)-3,4,5-trihydroxyoxan-2-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | COC(=O)C(NC(=O)OC(C)(C)C)[C@@H]1OC(CN=[N+]=[N-])[C@@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C14H24N4O8/c1-14(2,3)26-13(23)17-7(12(22)24-4)11-10(21)9(20)8(19)6(25-11)5-16-18-15/h6-11,19-21H,5H2,1-4H3,(H,17,23)/t6?,7?,8-,9+,10?,11+/m1/s1 |
| InChIKey | NVQSSCKNDOFMLM-NVCDZJQNSA-N |
| XLogP | -0.79 |
| TPSA | 183.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|