C17H31N3O5 — CID 177268561
ditert-butyl (2R)-2-[[methyl(methyliminomethyl)carbamoyl]amino]pentanedioate (PubChem CID 177268561) has the molecular formula C17H31N3O5 and a molecular weight of 357.45 g/mol. Its IUPAC name is ditert-butyl (2R)-2-[[methyl(methyliminomethyl)carbamoyl]amino]pentanedioate.
| Compound Name | ditert-butyl (2R)-2-[[methyl(methyliminomethyl)carbamoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 177268561 |
| Molecular Formula | C17H31N3O5 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | ditert-butyl (2R)-2-[[methyl(methyliminomethyl)carbamoyl]amino]pentanedioate |
| SMILES | C/N=C/N(C)C(=O)N[C@H](CCC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H31N3O5/c1-16(2,3)24-13(21)10-9-12(14(22)25-17(4,5)6)19-15(23)20(8)11-18-7/h11-12H,9-10H2,1-8H3,(H,19,23)/b18-11+/t12-/m1/s1 |
| InChIKey | LDOXDGGBDFXZDD-MBNTZHJCSA-N |
| XLogP | 2.12 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|