C26H20Cl5N3O2 — CID 122618794
2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(1,2,3,4-tetrahydroquinolin-6-yl)benzamide (PubChem CID 122618794) has the molecular formula C26H20Cl5N3O2 and a molecular weight of 583.73 g/mol. Its IUPAC name is 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(1,2,3,4-tetrahydroquinolin-6-yl)benzamide.
| Compound Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(1,2,3,4-tetrahydroquinolin-6-yl)benzamide |
|---|---|
| PubChem CID | 122618794 |
| Molecular Formula | C26H20Cl5N3O2 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 581.00 |
| IUPAC Name | 2-chloro-5-[[2,2-dichloro-3-(3,5-dichlorophenyl)cyclopropanecarbonyl]amino]-N-(1,2,3,4-tetrahydroquinolin-6-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)CCCN2)c1cc(NC(=O)C2C(c3cc(Cl)cc(Cl)c3)C2(Cl)Cl)ccc1Cl |
| InChI | InChI=1S/C26H20Cl5N3O2/c27-15-8-14(9-16(28)11-15)22-23(26(22,30)31)25(36)34-18-3-5-20(29)19(12-18)24(35)33-17-4-6-21-13(10-17)2-1-7-32-21/h3-6,8-12,22-23,32H,1-2,7H2,(H,33,35)(H,34,36) |
| InChIKey | PLIITTBRWUCARW-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|