C18H18ClN3O3S — CID 122619730
(7S)-1'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-hydroxy-2'-oxospiro[6,8-dihydro-5H-naphthalene-7,3'-pyrrolidine]-2-carboxamide (PubChem CID 122619730) has the molecular formula C18H18ClN3O3S and a molecular weight of 391.88 g/mol. Its IUPAC name is (7S)-1'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-hydroxy-2'-oxospiro[6,8-dihydro-5H-naphthalene-7,3'-pyrrolidine]-2-carboxamide.
| Compound Name | (7S)-1'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-hydroxy-2'-oxospiro[6,8-dihydro-5H-naphthalene-7,3'-pyrrolidine]-2-carboxamide |
|---|---|
| PubChem CID | 122619730 |
| Molecular Formula | C18H18ClN3O3S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | (7S)-1'-[(2-chloro-1,3-thiazol-5-yl)methyl]-N-hydroxy-2'-oxospiro[6,8-dihydro-5H-naphthalene-7,3'-pyrrolidine]-2-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)C[C@@]1(CC2)CCN(Cc2cnc(Cl)s2)C1=O |
| InChI | InChI=1S/C18H18ClN3O3S/c19-17-20-9-14(26-17)10-22-6-5-18(16(22)24)4-3-11-1-2-12(15(23)21-25)7-13(11)8-18/h1-2,7,9,25H,3-6,8,10H2,(H,21,23)/t18-/m1/s1 |
| InChIKey | VNNVUFDFOFZVRU-GOSISDBHSA-N |
| XLogP | 2.82 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|