C8H9NO2 — CID 122623826
1-hydroxy-6,7-dihydro-5H-cyclopenta[b]pyridin-2-one (PubChem CID 122623826) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 1-hydroxy-6,7-dihydro-5H-cyclopenta[b]pyridin-2-one.
| Compound Name | 1-hydroxy-6,7-dihydro-5H-cyclopenta[b]pyridin-2-one |
|---|---|
| PubChem CID | 122623826 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 1-hydroxy-6,7-dihydro-5H-cyclopenta[b]pyridin-2-one |
| SMILES | O=c1ccc2c(n1O)CCC2 |
| InChI | InChI=1S/C8H9NO2/c10-8-5-4-6-2-1-3-7(6)9(8)11/h4-5,11H,1-3H2 |
| InChIKey | AQYKPTIGEXYVTN-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|