C16H21ClFN5 — CID 122624110
N-(4-fluorophenyl)-6-methyl-2-(2-methylpiperazin-1-yl)pyrimidin-4-amine;hydrochloride (PubChem CID 122624110) has the molecular formula C16H21ClFN5 and a molecular weight of 337.83 g/mol. Its IUPAC name is N-(4-fluorophenyl)-6-methyl-2-(2-methylpiperazin-1-yl)pyrimidin-4-amine;hydrochloride.
| Compound Name | N-(4-fluorophenyl)-6-methyl-2-(2-methylpiperazin-1-yl)pyrimidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 122624110 |
| Molecular Formula | C16H21ClFN5 |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-(4-fluorophenyl)-6-methyl-2-(2-methylpiperazin-1-yl)pyrimidin-4-amine;hydrochloride |
| SMILES | Cc1cc(Nc2ccc(F)cc2)nc(N2CCNCC2C)n1.Cl |
| InChI | InChI=1S/C16H20FN5.ClH/c1-11-9-15(20-14-5-3-13(17)4-6-14)21-16(19-11)22-8-7-18-10-12(22)2;/h3-6,9,12,18H,7-8,10H2,1-2H3,(H,19,20,21);1H |
| InChIKey | JXKCVQVTZVCBLG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |