C16H20FN5 — CID 134410157
2-(1,4-diazepan-1-yl)-N-(4-fluorophenyl)-6-methylpyrimidin-4-amine (PubChem CID 134410157) has the molecular formula C16H20FN5 and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(4-fluorophenyl)-6-methylpyrimidin-4-amine.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(4-fluorophenyl)-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 134410157 |
| Molecular Formula | C16H20FN5 |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(4-fluorophenyl)-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(Nc2ccc(F)cc2)nc(N2CCCNCC2)n1 |
| InChI | InChI=1S/C16H20FN5/c1-12-11-15(20-14-5-3-13(17)4-6-14)21-16(19-12)22-9-2-7-18-8-10-22/h3-6,11,18H,2,7-10H2,1H3,(H,19,20,21) |
| InChIKey | QEDYTKBORZQGMT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |