C26H34N4O — CID 122624237
2-[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]-N-[(1-phenylpyrazol-4-yl)methyl]ethanamine (PubChem CID 122624237) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is 2-[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]-N-[(1-phenylpyrazol-4-yl)methyl]ethanamine.
| Compound Name | 2-[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]-N-[(1-phenylpyrazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 122624237 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 2-[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]-N-[(1-phenylpyrazol-4-yl)methyl]ethanamine |
| SMILES | COc1ccc(CCN2CCC(CCNCc3cnn(-c4ccccc4)c3)CC2)cc1 |
| InChI | InChI=1S/C26H34N4O/c1-31-26-9-7-22(8-10-26)12-16-29-17-13-23(14-18-29)11-15-27-19-24-20-28-30(21-24)25-5-3-2-4-6-25/h2-10,20-21,23,27H,11-19H2,1H3 |
| InChIKey | HUISCMVVKZDLAQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|