C21H22N2O3 — CID 122624658
(6R)-N-benzyl-N-hydroxy-2'-oxospiro[7,8-dihydro-5H-naphthalene-6,4'-pyrrolidine]-2-carboxamide (PubChem CID 122624658) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (6R)-N-benzyl-N-hydroxy-2'-oxospiro[7,8-dihydro-5H-naphthalene-6,4'-pyrrolidine]-2-carboxamide.
| Compound Name | (6R)-N-benzyl-N-hydroxy-2'-oxospiro[7,8-dihydro-5H-naphthalene-6,4'-pyrrolidine]-2-carboxamide |
|---|---|
| PubChem CID | 122624658 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (6R)-N-benzyl-N-hydroxy-2'-oxospiro[7,8-dihydro-5H-naphthalene-6,4'-pyrrolidine]-2-carboxamide |
| SMILES | O=C1C[C@]2(CCc3cc(C(=O)N(O)Cc4ccccc4)ccc3C2)CN1 |
| InChI | InChI=1S/C21H22N2O3/c24-19-12-21(14-22-19)9-8-16-10-17(6-7-18(16)11-21)20(25)23(26)13-15-4-2-1-3-5-15/h1-7,10,26H,8-9,11-14H2,(H,22,24)/t21-/m1/s1 |
| InChIKey | DPMXGGRUGAFHTP-OAQYLSRUSA-N |
| XLogP | 2.71 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|