C57H58F3N3S3 — CID 122625766
4-[5-[9-heptadecan-9-yl-7-(4-methylphenyl)carbazol-2-yl]thiophen-2-yl]-7-[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazole (PubChem CID 122625766) has the molecular formula C57H58F3N3S3 and a molecular weight of 938.31 g/mol. Its IUPAC name is 4-[5-[9-heptadecan-9-yl-7-(4-methylphenyl)carbazol-2-yl]thiophen-2-yl]-7-[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazole.
| Compound Name | 4-[5-[9-heptadecan-9-yl-7-(4-methylphenyl)carbazol-2-yl]thiophen-2-yl]-7-[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 122625766 |
| Molecular Formula | C57H58F3N3S3 |
| Molecular Weight | 938.31 g/mol |
| Exact Mass | 937.37 |
| IUPAC Name | 4-[5-[9-heptadecan-9-yl-7-(4-methylphenyl)carbazol-2-yl]thiophen-2-yl]-7-[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazole |
| SMILES | CCCCCCCCC(CCCCCCCC)n1c2cc(-c3ccc(C)cc3)ccc2c2ccc(-c3ccc(-c4ccc(-c5ccc(-c6ccc(C(F)(F)F)cc6)s5)c5nsnc45)s3)cc21 |
| InChI | InChI=1S/C57H58F3N3S3/c1-4-6-8-10-12-14-16-44(17-15-13-11-9-7-5-2)63-49-36-41(39-20-18-38(3)19-21-39)24-28-45(49)46-29-25-42(37-50(46)63)52-33-35-54(65-52)48-31-30-47(55-56(48)62-66-61-55)53-34-32-51(64-53)40-22-26-43(27-23-40)57(58,59)60/h18-37,44H,4-17H2,1-3H3 |
| InChIKey | MNMJOWKZNHMHJS-UHFFFAOYSA-N |
| XLogP | 19.63 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.31 |
| LogP ≤ 5 | 19.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|