C50H43F2N3S2 — CID 58500644
2-[5-[6,7-difluoro-8-(5-methylthiophen-2-yl)-2,3-diphenylquinoxalin-5-yl]thiophen-2-yl]-7-methyl-9-octylcarbazole (PubChem CID 58500644) has the molecular formula C50H43F2N3S2 and a molecular weight of 788.05 g/mol. Its IUPAC name is 2-[5-[6,7-difluoro-8-(5-methylthiophen-2-yl)-2,3-diphenylquinoxalin-5-yl]thiophen-2-yl]-7-methyl-9-octylcarbazole.
| Compound Name | 2-[5-[6,7-difluoro-8-(5-methylthiophen-2-yl)-2,3-diphenylquinoxalin-5-yl]thiophen-2-yl]-7-methyl-9-octylcarbazole |
|---|---|
| PubChem CID | 58500644 |
| Molecular Formula | C50H43F2N3S2 |
| Molecular Weight | 788.05 g/mol |
| Exact Mass | 787.29 |
| IUPAC Name | 2-[5-[6,7-difluoro-8-(5-methylthiophen-2-yl)-2,3-diphenylquinoxalin-5-yl]thiophen-2-yl]-7-methyl-9-octylcarbazole |
| SMILES | CCCCCCCCn1c2cc(C)ccc2c2ccc(-c3ccc(-c4c(F)c(F)c(-c5ccc(C)s5)c5nc(-c6ccccc6)c(-c6ccccc6)nc45)s3)cc21 |
| InChI | InChI=1S/C50H43F2N3S2/c1-4-5-6-7-8-15-28-55-38-29-31(2)20-23-36(38)37-24-22-35(30-39(37)55)40-26-27-42(57-40)44-46(52)45(51)43(41-25-21-32(3)56-41)49-50(44)54-48(34-18-13-10-14-19-34)47(53-49)33-16-11-9-12-17-33/h9-14,16-27,29-30H,4-8,15,28H2,1-3H3 |
| InChIKey | IGWILEZLPAIGJV-UHFFFAOYSA-N |
| XLogP | 15.45 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.05 |
| LogP ≤ 5 | 15.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|