C60H64F2N2S2Si — CID 58500542
5-(4,5-dimethylthiophen-2-yl)-2,3-bis(4-fluorophenyl)-8-[4-methyl-5-(7-methyl-5,5-dioctylbenzo[b][1]benzosilol-3-yl)thiophen-2-yl]quinoxaline (PubChem CID 58500542) has the molecular formula C60H64F2N2S2Si and a molecular weight of 943.40 g/mol. Its IUPAC name is 5-(4,5-dimethylthiophen-2-yl)-2,3-bis(4-fluorophenyl)-8-[4-methyl-5-(7-methyl-5,5-dioctylbenzo[b][1]benzosilol-3-yl)thiophen-2-yl]quinoxaline.
| Compound Name | 5-(4,5-dimethylthiophen-2-yl)-2,3-bis(4-fluorophenyl)-8-[4-methyl-5-(7-methyl-5,5-dioctylbenzo[b][1]benzosilol-3-yl)thiophen-2-yl]quinoxaline |
|---|---|
| PubChem CID | 58500542 |
| Molecular Formula | C60H64F2N2S2Si |
| Molecular Weight | 943.40 g/mol |
| Exact Mass | 942.42 |
| IUPAC Name | 5-(4,5-dimethylthiophen-2-yl)-2,3-bis(4-fluorophenyl)-8-[4-methyl-5-(7-methyl-5,5-dioctylbenzo[b][1]benzosilol-3-yl)thiophen-2-yl]quinoxaline |
| SMILES | CCCCCCCC[Si]1(CCCCCCCC)c2cc(C)ccc2-c2ccc(-c3sc(-c4ccc(-c5cc(C)c(C)s5)c5nc(-c6ccc(F)cc6)c(-c6ccc(F)cc6)nc45)cc3C)cc21 |
| InChI | InChI=1S/C60H64F2N2S2Si/c1-7-9-11-13-15-17-33-67(34-18-16-14-12-10-8-2)54-35-39(3)19-29-48(54)49-30-24-45(38-55(49)67)60-41(5)37-53(66-60)51-32-31-50(52-36-40(4)42(6)65-52)58-59(51)64-57(44-22-27-47(62)28-23-44)56(63-58)43-20-25-46(61)26-21-43/h19-32,35-38H,7-18,33-34H2,1-6H3 |
| InChIKey | GIRQCWORUBORGH-UHFFFAOYSA-N |
| XLogP | 17.86 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.40 |
| LogP ≤ 5 | 17.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|