C59H60F2N2S2 — CID 58500552
6,7-difluoro-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-diphenylquinoxaline (PubChem CID 58500552) has the molecular formula C59H60F2N2S2 and a molecular weight of 899.27 g/mol. Its IUPAC name is 6,7-difluoro-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-diphenylquinoxaline.
| Compound Name | 6,7-difluoro-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-diphenylquinoxaline |
|---|---|
| PubChem CID | 58500552 |
| Molecular Formula | C59H60F2N2S2 |
| Molecular Weight | 899.27 g/mol |
| Exact Mass | 898.42 |
| IUPAC Name | 6,7-difluoro-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)-2,3-diphenylquinoxaline |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2ccc(-c3ccc(-c4c(F)c(F)c(-c5ccc(C)s5)c5nc(-c6ccccc6)c(-c6ccccc6)nc45)s3)cc21 |
| InChI | InChI=1S/C59H60F2N2S2/c1-5-7-9-11-13-21-35-59(36-22-14-12-10-8-6-2)46-37-39(3)27-30-44(46)45-31-29-43(38-47(45)59)48-33-34-50(65-48)52-54(61)53(60)51(49-32-28-40(4)64-49)57-58(52)63-56(42-25-19-16-20-26-42)55(62-57)41-23-17-15-18-24-41/h15-20,23-34,37-38H,5-14,21-22,35-36H2,1-4H3 |
| InChIKey | BCSKJASIFCTRCT-UHFFFAOYSA-N |
| XLogP | 18.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.27 |
| LogP ≤ 5 | 18.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|