C59H58F4N2S2 — CID 58500554
6,7-difluoro-2,3-bis(4-fluorophenyl)-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)quinoxaline (PubChem CID 58500554) has the molecular formula C59H58F4N2S2 and a molecular weight of 935.25 g/mol. Its IUPAC name is 6,7-difluoro-2,3-bis(4-fluorophenyl)-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)quinoxaline.
| Compound Name | 6,7-difluoro-2,3-bis(4-fluorophenyl)-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)quinoxaline |
|---|---|
| PubChem CID | 58500554 |
| Molecular Formula | C59H58F4N2S2 |
| Molecular Weight | 935.25 g/mol |
| Exact Mass | 934.40 |
| IUPAC Name | 6,7-difluoro-2,3-bis(4-fluorophenyl)-5-[5-(7-methyl-9,9-dioctylfluoren-2-yl)thiophen-2-yl]-8-(5-methylthiophen-2-yl)quinoxaline |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2ccc(-c3ccc(-c4c(F)c(F)c(-c5ccc(C)s5)c5nc(-c6ccc(F)cc6)c(-c6ccc(F)cc6)nc45)s3)cc21 |
| InChI | InChI=1S/C59H58F4N2S2/c1-5-7-9-11-13-15-33-59(34-16-14-12-10-8-6-2)46-35-37(3)17-28-44(46)45-29-23-41(36-47(45)59)48-31-32-50(67-48)52-54(63)53(62)51(49-30-18-38(4)66-49)57-58(52)65-56(40-21-26-43(61)27-22-40)55(64-57)39-19-24-42(60)25-20-39/h17-32,35-36H,5-16,33-34H2,1-4H3 |
| InChIKey | BOSRRARKPJNTFH-UHFFFAOYSA-N |
| XLogP | 19.03 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.25 |
| LogP ≤ 5 | 19.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|