C46H55F3N2S2Se2 — CID 58090514
2,3-didecyl-5-(5-methylselenophen-2-yl)-8-[5-[5-[5-(trifluoromethyl)selenophen-2-yl]thiophen-2-yl]thiophen-2-yl]quinoxaline (PubChem CID 58090514) has the molecular formula C46H55F3N2S2Se2 and a molecular weight of 915.01 g/mol. Its IUPAC name is 2,3-didecyl-5-(5-methylselenophen-2-yl)-8-[5-[5-[5-(trifluoromethyl)selenophen-2-yl]thiophen-2-yl]thiophen-2-yl]quinoxaline.
| Compound Name | 2,3-didecyl-5-(5-methylselenophen-2-yl)-8-[5-[5-[5-(trifluoromethyl)selenophen-2-yl]thiophen-2-yl]thiophen-2-yl]quinoxaline |
|---|---|
| PubChem CID | 58090514 |
| Molecular Formula | C46H55F3N2S2Se2 |
| Molecular Weight | 915.01 g/mol |
| Exact Mass | 916.21 |
| IUPAC Name | 2,3-didecyl-5-(5-methylselenophen-2-yl)-8-[5-[5-[5-(trifluoromethyl)selenophen-2-yl]thiophen-2-yl]thiophen-2-yl]quinoxaline |
| SMILES | CCCCCCCCCCc1nc2c(-c3ccc(-c4ccc(-c5ccc(C(F)(F)F)[se]5)s4)s3)ccc(-c3ccc(C)[se]3)c2nc1CCCCCCCCCC |
| InChI | InChI=1S/C46H55F3N2S2Se2/c1-4-6-8-10-12-14-16-18-20-35-36(21-19-17-15-13-11-9-7-5-2)51-45-34(41-29-22-32(3)54-41)24-23-33(44(45)50-35)37-25-26-38(52-37)39-27-28-40(53-39)42-30-31-43(55-42)46(47,48)49/h22-31H,4-21H2,1-3H3 |
| InChIKey | NKHWTNJCVNQZGW-UHFFFAOYSA-N |
| XLogP | 15.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.01 |
| LogP ≤ 5 | 15.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|