C56H76N4S5 — CID 166643342
6,7-bis[5-(2-hexyldecyl)thiophen-2-yl]-4,9-dithiophen-2-yl-[1,2,5]thiadiazolo[3,4-g]quinoxaline (PubChem CID 166643342) has the molecular formula C56H76N4S5 and a molecular weight of 965.59 g/mol. Its IUPAC name is 6,7-bis[5-(2-hexyldecyl)thiophen-2-yl]-4,9-dithiophen-2-yl-[1,2,5]thiadiazolo[3,4-g]quinoxaline.
| Compound Name | 6,7-bis[5-(2-hexyldecyl)thiophen-2-yl]-4,9-dithiophen-2-yl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
|---|---|
| PubChem CID | 166643342 |
| Molecular Formula | C56H76N4S5 |
| Molecular Weight | 965.59 g/mol |
| Exact Mass | 964.47 |
| IUPAC Name | 6,7-bis[5-(2-hexyldecyl)thiophen-2-yl]-4,9-dithiophen-2-yl-[1,2,5]thiadiazolo[3,4-g]quinoxaline |
| SMILES | CCCCCCCCC(CCCCCC)Cc1ccc(-c2nc3c(-c4cccs4)c4nsnc4c(-c4cccs4)c3nc2-c2ccc(CC(CCCCCC)CCCCCCCC)s2)s1 |
| InChI | InChI=1S/C56H76N4S5/c1-5-9-13-17-19-23-29-41(27-21-15-11-7-3)39-43-33-35-47(63-43)51-52(48-36-34-44(64-48)40-42(28-22-16-12-8-4)30-24-20-18-14-10-6-2)58-54-50(46-32-26-38-62-46)56-55(59-65-60-56)49(53(54)57-51)45-31-25-37-61-45/h25-26,31-38,41-42H,5-24,27-30,39-40H2,1-4H3 |
| InChIKey | ZCVSUWBZYOJJQU-UHFFFAOYSA-N |
| XLogP | 20.31 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.59 |
| LogP ≤ 5 | 20.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|