C22H18Cl4F2N2O2 — CID 122630203
3-[[2,2-dichloro-3-(3,5-dichlorophenyl)-3-methylcyclopropanecarbonyl]amino]-N-(3,3-difluorocyclobutyl)benzamide (PubChem CID 122630203) has the molecular formula C22H18Cl4F2N2O2 and a molecular weight of 522.21 g/mol. Its IUPAC name is 3-[[2,2-dichloro-3-(3,5-dichlorophenyl)-3-methylcyclopropanecarbonyl]amino]-N-(3,3-difluorocyclobutyl)benzamide.
| Compound Name | 3-[[2,2-dichloro-3-(3,5-dichlorophenyl)-3-methylcyclopropanecarbonyl]amino]-N-(3,3-difluorocyclobutyl)benzamide |
|---|---|
| PubChem CID | 122630203 |
| Molecular Formula | C22H18Cl4F2N2O2 |
| Molecular Weight | 522.21 g/mol |
| Exact Mass | 520.01 |
| IUPAC Name | 3-[[2,2-dichloro-3-(3,5-dichlorophenyl)-3-methylcyclopropanecarbonyl]amino]-N-(3,3-difluorocyclobutyl)benzamide |
| SMILES | CC1(c2cc(Cl)cc(Cl)c2)C(C(=O)Nc2cccc(C(=O)NC3CC(F)(F)C3)c2)C1(Cl)Cl |
| InChI | InChI=1S/C22H18Cl4F2N2O2/c1-20(12-6-13(23)8-14(24)7-12)17(22(20,25)26)19(32)29-15-4-2-3-11(5-15)18(31)30-16-9-21(27,28)10-16/h2-8,16-17H,9-10H2,1H3,(H,29,32)(H,30,31) |
| InChIKey | HCXXHEGBSJQENF-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.21 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|