C13H17ClO3 — CID 122638184
(6-chloro-2,2-diethyl-4H-1,3-benzodioxin-4-yl)methanol (PubChem CID 122638184) has the molecular formula C13H17ClO3 and a molecular weight of 256.73 g/mol. Its IUPAC name is (6-chloro-2,2-diethyl-4H-1,3-benzodioxin-4-yl)methanol.
| Compound Name | (6-chloro-2,2-diethyl-4H-1,3-benzodioxin-4-yl)methanol |
|---|---|
| PubChem CID | 122638184 |
| Molecular Formula | C13H17ClO3 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (6-chloro-2,2-diethyl-4H-1,3-benzodioxin-4-yl)methanol |
| SMILES | CCC1(CC)Oc2ccc(Cl)cc2C(CO)O1 |
| InChI | InChI=1S/C13H17ClO3/c1-3-13(4-2)16-11-6-5-9(14)7-10(11)12(8-15)17-13/h5-7,12,15H,3-4,8H2,1-2H3 |
| InChIKey | ZYQOHDWUXCNGCY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |