C24H21BrINO4 — CID 122638917
benzyl 3-(2-bromo-4-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 122638917) has the molecular formula C24H21BrINO4 and a molecular weight of 594.24 g/mol. Its IUPAC name is benzyl 3-(2-bromo-4-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | benzyl 3-(2-bromo-4-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 122638917 |
| Molecular Formula | C24H21BrINO4 |
| Molecular Weight | 594.24 g/mol |
| Exact Mass | 592.97 |
| IUPAC Name | benzyl 3-(2-bromo-4-iodophenyl)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | O=C(NC(Cc1ccc(I)cc1Br)C(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C24H21BrINO4/c25-21-14-20(26)12-11-19(21)13-22(23(28)30-15-17-7-3-1-4-8-17)27-24(29)31-16-18-9-5-2-6-10-18/h1-12,14,22H,13,15-16H2,(H,27,29) |
| InChIKey | AZKDTNBFBJJJMY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.24 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|