C24H23BrINO3 — CID 122636002
benzyl N-[1-(2-bromo-4-iodophenyl)-3-hydroxy-4-phenylbutan-2-yl]carbamate (PubChem CID 122636002) has the molecular formula C24H23BrINO3 and a molecular weight of 580.26 g/mol. Its IUPAC name is benzyl N-[1-(2-bromo-4-iodophenyl)-3-hydroxy-4-phenylbutan-2-yl]carbamate.
| Compound Name | benzyl N-[1-(2-bromo-4-iodophenyl)-3-hydroxy-4-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 122636002 |
| Molecular Formula | C24H23BrINO3 |
| Molecular Weight | 580.26 g/mol |
| Exact Mass | 578.99 |
| IUPAC Name | benzyl N-[1-(2-bromo-4-iodophenyl)-3-hydroxy-4-phenylbutan-2-yl]carbamate |
| SMILES | O=C(NC(Cc1ccc(I)cc1Br)C(O)Cc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C24H23BrINO3/c25-21-15-20(26)12-11-19(21)14-22(23(28)13-17-7-3-1-4-8-17)27-24(29)30-16-18-9-5-2-6-10-18/h1-12,15,22-23,28H,13-14,16H2,(H,27,29) |
| InChIKey | YNDLKYFSPUYHRO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.26 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|