C26H30N2O2S — CID 122658332
N-[(4-methyl-1,3-thiazol-2-yl)methyl]-N-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]cyclohexanamine (PubChem CID 122658332) has the molecular formula C26H30N2O2S and a molecular weight of 434.61 g/mol. Its IUPAC name is N-[(4-methyl-1,3-thiazol-2-yl)methyl]-N-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]cyclohexanamine.
| Compound Name | N-[(4-methyl-1,3-thiazol-2-yl)methyl]-N-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]cyclohexanamine |
|---|---|
| PubChem CID | 122658332 |
| Molecular Formula | C26H30N2O2S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-[(4-methyl-1,3-thiazol-2-yl)methyl]-N-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]cyclohexanamine |
| SMILES | Cc1csc(CN(Oc2ccc3c(c2)CCC(c2ccccc2)O3)C2CCCCC2)n1 |
| InChI | InChI=1S/C26H30N2O2S/c1-19-18-31-26(27-19)17-28(22-10-6-3-7-11-22)30-23-13-15-25-21(16-23)12-14-24(29-25)20-8-4-2-5-9-20/h2,4-5,8-9,13,15-16,18,22,24H,3,6-7,10-12,14,17H2,1H3 |
| InChIKey | DZYMNAGKCFOLFO-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|