C13H20N2 — CID 122659058
[(E)-(3,3-dimethyl-1-phenylbutylidene)amino]methanamine (PubChem CID 122659058) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is [(E)-(3,3-dimethyl-1-phenylbutylidene)amino]methanamine.
| Compound Name | [(E)-(3,3-dimethyl-1-phenylbutylidene)amino]methanamine |
|---|---|
| PubChem CID | 122659058 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | [(E)-(3,3-dimethyl-1-phenylbutylidene)amino]methanamine |
| SMILES | CC(C)(C)C/C(=N\CN)c1ccccc1 |
| InChI | InChI=1S/C13H20N2/c1-13(2,3)9-12(15-10-14)11-7-5-4-6-8-11/h4-8H,9-10,14H2,1-3H3/b15-12+ |
| InChIKey | AJWUELJASRUVJL-NTCAYCPXSA-N |
| XLogP | 2.83 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|