C18H16N2O5S — CID 122659863
5-(3-methoxypropylsulfanyl)-4,7-dioxo-N-phenyl-1,2-benzoxazole-3-carboxamide (PubChem CID 122659863) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is 5-(3-methoxypropylsulfanyl)-4,7-dioxo-N-phenyl-1,2-benzoxazole-3-carboxamide.
| Compound Name | 5-(3-methoxypropylsulfanyl)-4,7-dioxo-N-phenyl-1,2-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 122659863 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 5-(3-methoxypropylsulfanyl)-4,7-dioxo-N-phenyl-1,2-benzoxazole-3-carboxamide |
| SMILES | COCCCSC1=CC(=O)c2onc(C(=O)Nc3ccccc3)c2C1=O |
| InChI | InChI=1S/C18H16N2O5S/c1-24-8-5-9-26-13-10-12(21)17-14(16(13)22)15(20-25-17)18(23)19-11-6-3-2-4-7-11/h2-4,6-7,10H,5,8-9H2,1H3,(H,19,23) |
| InChIKey | ORMFEAXKDVIZQB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|