C18H18N4O4S — CID 123350962
5-[2-(methoxymethylamino)ethylsulfanyl]-4,7-dioxo-N-phenyl-2H-indazole-3-carboxamide (PubChem CID 123350962) has the molecular formula C18H18N4O4S and a molecular weight of 386.43 g/mol. Its IUPAC name is 5-[2-(methoxymethylamino)ethylsulfanyl]-4,7-dioxo-N-phenyl-2H-indazole-3-carboxamide.
| Compound Name | 5-[2-(methoxymethylamino)ethylsulfanyl]-4,7-dioxo-N-phenyl-2H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 123350962 |
| Molecular Formula | C18H18N4O4S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 5-[2-(methoxymethylamino)ethylsulfanyl]-4,7-dioxo-N-phenyl-2H-indazole-3-carboxamide |
| SMILES | COCNCCSC1=CC(=O)c2n[nH]c(C(=O)Nc3ccccc3)c2C1=O |
| InChI | InChI=1S/C18H18N4O4S/c1-26-10-19-7-8-27-13-9-12(23)15-14(17(13)24)16(22-21-15)18(25)20-11-5-3-2-4-6-11/h2-6,9,19H,7-8,10H2,1H3,(H,20,25)(H,21,22) |
| InChIKey | GDYZDVAVMUYEPR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|