C17H13ClN2O4S — CID 122659893
ethyl 5-[(4-chlorophenyl)methylsulfanyl]-4,7-dioxo-2H-indazole-3-carboxylate (PubChem CID 122659893) has the molecular formula C17H13ClN2O4S and a molecular weight of 376.82 g/mol. Its IUPAC name is ethyl 5-[(4-chlorophenyl)methylsulfanyl]-4,7-dioxo-2H-indazole-3-carboxylate.
| Compound Name | ethyl 5-[(4-chlorophenyl)methylsulfanyl]-4,7-dioxo-2H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 122659893 |
| Molecular Formula | C17H13ClN2O4S |
| Molecular Weight | 376.82 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | ethyl 5-[(4-chlorophenyl)methylsulfanyl]-4,7-dioxo-2H-indazole-3-carboxylate |
| SMILES | CCOC(=O)c1[nH]nc2c1C(=O)C(SCc1ccc(Cl)cc1)=CC2=O |
| InChI | InChI=1S/C17H13ClN2O4S/c1-2-24-17(23)15-13-14(19-20-15)11(21)7-12(16(13)22)25-8-9-3-5-10(18)6-4-9/h3-7H,2,8H2,1H3,(H,19,20) |
| InChIKey | QPLOVZVSZMMXDE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.82 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|