C15H18N4O4S — CID 160584969
N-methyl-4,7-dioxo-5-[3-(propanoylamino)propylsulfanyl]-2H-indazole-3-carboxamide (PubChem CID 160584969) has the molecular formula C15H18N4O4S and a molecular weight of 350.40 g/mol. Its IUPAC name is N-methyl-4,7-dioxo-5-[3-(propanoylamino)propylsulfanyl]-2H-indazole-3-carboxamide.
| Compound Name | N-methyl-4,7-dioxo-5-[3-(propanoylamino)propylsulfanyl]-2H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 160584969 |
| Molecular Formula | C15H18N4O4S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-methyl-4,7-dioxo-5-[3-(propanoylamino)propylsulfanyl]-2H-indazole-3-carboxamide |
| SMILES | CCC(=O)NCCCSC1=CC(=O)c2n[nH]c(C(=O)NC)c2C1=O |
| InChI | InChI=1S/C15H18N4O4S/c1-3-10(21)17-5-4-6-24-9-7-8(20)12-11(14(9)22)13(19-18-12)15(23)16-2/h7H,3-6H2,1-2H3,(H,16,23)(H,17,21)(H,18,19) |
| InChIKey | RCGUSXWDTSKCPL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|